Overslaan naar inhoud

Oleylamine, min. 95%5g

https://www.ecbol.org/web/image/product.template/34262/image_1920?unique=eb928c4
Oleylamine, min. 95% (CAS: 112-90-3) has the chemical formula CH3(CH2)7CHCH(CH2)7CH2NH2 and a molecular weight of 267.49 g/mol It typically appears as colorless liq. with a purity of min. 95% and a flash point of nan commonly used in chemical synthesis or laboratory applications.

86,00 € 86.0 EUR 86,00 €

86,00 €

Not Available For Sale

Deze combinatie bestaat niet.

Algemene voorwaarden
30-dagen geld terug garantie
Verzending: 2-3 werkdagen